C14H20N4O2S — CID 747121
3-methyl-8-(3-methylbutylsulfanyl)-7-prop-2-enylpurine-2,6-dione (PubChem CID 747121) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 3-methyl-8-(3-methylbutylsulfanyl)-7-prop-2-enylpurine-2,6-dione.
| Compound Name | 3-methyl-8-(3-methylbutylsulfanyl)-7-prop-2-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 747121 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 3-methyl-8-(3-methylbutylsulfanyl)-7-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1c(SCCC(C)C)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C14H20N4O2S/c1-5-7-18-10-11(17(4)13(20)16-12(10)19)15-14(18)21-8-6-9(2)3/h5,9H,1,6-8H2,2-4H3,(H,16,19,20) |
| InChIKey | WPPDGGCJCGKTDE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|