C15H14N4O2S — CID 1092001
3-methyl-8-phenylsulfanyl-7-prop-2-enylpurine-2,6-dione (PubChem CID 1092001) has the molecular formula C15H14N4O2S and a molecular weight of 314.37 g/mol. Its IUPAC name is 3-methyl-8-phenylsulfanyl-7-prop-2-enylpurine-2,6-dione.
| Compound Name | 3-methyl-8-phenylsulfanyl-7-prop-2-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 1092001 |
| Molecular Formula | C15H14N4O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 3-methyl-8-phenylsulfanyl-7-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1c(Sc2ccccc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C15H14N4O2S/c1-3-9-19-11-12(18(2)14(21)17-13(11)20)16-15(19)22-10-7-5-4-6-8-10/h3-8H,1,9H2,2H3,(H,17,20,21) |
| InChIKey | GPEGXNJAMFBIDZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|