C21H18Cl2N4O2S2 — CID 44967677
8-(4-chlorophenyl)sulfanyl-7-[3-(4-chlorophenyl)sulfanylpropyl]-3-methylpurine-2,6-dione (PubChem CID 44967677) has the molecular formula C21H18Cl2N4O2S2 and a molecular weight of 493.44 g/mol. Its IUPAC name is 8-(4-chlorophenyl)sulfanyl-7-[3-(4-chlorophenyl)sulfanylpropyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-(4-chlorophenyl)sulfanyl-7-[3-(4-chlorophenyl)sulfanylpropyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 44967677 |
| Molecular Formula | C21H18Cl2N4O2S2 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | 8-(4-chlorophenyl)sulfanyl-7-[3-(4-chlorophenyl)sulfanylpropyl]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(Sc1ccc(Cl)cc1)n2CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18Cl2N4O2S2/c1-26-18-17(19(28)25-20(26)29)27(11-2-12-30-15-7-3-13(22)4-8-15)21(24-18)31-16-9-5-14(23)6-10-16/h3-10H,2,11-12H2,1H3,(H,25,28,29) |
| InChIKey | VMMMXJSEPJEVCX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|