C16H14N6O2S — CID 122505989
7-benzyl-8-(1H-imidazol-2-ylsulfanyl)-3-methylpurine-2,6-dione (PubChem CID 122505989) has the molecular formula C16H14N6O2S and a molecular weight of 354.40 g/mol. Its IUPAC name is 7-benzyl-8-(1H-imidazol-2-ylsulfanyl)-3-methylpurine-2,6-dione.
| Compound Name | 7-benzyl-8-(1H-imidazol-2-ylsulfanyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 122505989 |
| Molecular Formula | C16H14N6O2S |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 7-benzyl-8-(1H-imidazol-2-ylsulfanyl)-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(Sc1ncc[nH]1)n2Cc1ccccc1 |
| InChI | InChI=1S/C16H14N6O2S/c1-21-12-11(13(23)20-15(21)24)22(9-10-5-3-2-4-6-10)16(19-12)25-14-17-7-8-18-14/h2-8H,9H2,1H3,(H,17,18)(H,20,23,24) |
| InChIKey | AZRCHHAEHCUIGC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |