C15H17N5O4 — CID 3761570
7-benzyl-8-[bis(hydroxymethyl)amino]-3-methylpurine-2,6-dione (PubChem CID 3761570) has the molecular formula C15H17N5O4 and a molecular weight of 331.33 g/mol. Its IUPAC name is 7-benzyl-8-[bis(hydroxymethyl)amino]-3-methylpurine-2,6-dione.
| Compound Name | 7-benzyl-8-[bis(hydroxymethyl)amino]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 3761570 |
| Molecular Formula | C15H17N5O4 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 7-benzyl-8-[bis(hydroxymethyl)amino]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N(CO)CO)n2Cc1ccccc1 |
| InChI | InChI=1S/C15H17N5O4/c1-18-12-11(13(23)17-15(18)24)20(7-10-5-3-2-4-6-10)14(16-12)19(8-21)9-22/h2-6,21-22H,7-9H2,1H3,(H,17,23,24) |
| InChIKey | PGWVJSHEZWVOIK-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 116.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|