C19H23N5O2 — CID 1089313
7-benzyl-3-methyl-8-(4-methylpiperidin-1-yl)purine-2,6-dione (PubChem CID 1089313) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 7-benzyl-3-methyl-8-(4-methylpiperidin-1-yl)purine-2,6-dione.
| Compound Name | 7-benzyl-3-methyl-8-(4-methylpiperidin-1-yl)purine-2,6-dione |
|---|---|
| PubChem CID | 1089313 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 7-benzyl-3-methyl-8-(4-methylpiperidin-1-yl)purine-2,6-dione |
| SMILES | CC1CCN(c2nc3c(c(=O)[nH]c(=O)n3C)n2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H23N5O2/c1-13-8-10-23(11-9-13)18-20-16-15(17(25)21-19(26)22(16)2)24(18)12-14-6-4-3-5-7-14/h3-7,13H,8-12H2,1-2H3,(H,21,25,26) |
| InChIKey | FGGHRIPENMFTQC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |