C22H27N9O2S — CID 5028441
3-methyl-8-(4-methylpiperidin-1-yl)-7-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]purine-2,6-dione (PubChem CID 5028441) has the molecular formula C22H27N9O2S and a molecular weight of 481.59 g/mol. Its IUPAC name is 3-methyl-8-(4-methylpiperidin-1-yl)-7-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]purine-2,6-dione.
| Compound Name | 3-methyl-8-(4-methylpiperidin-1-yl)-7-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]purine-2,6-dione |
|---|---|
| PubChem CID | 5028441 |
| Molecular Formula | C22H27N9O2S |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 3-methyl-8-(4-methylpiperidin-1-yl)-7-[3-(1-phenyltetrazol-5-yl)sulfanylpropyl]purine-2,6-dione |
| SMILES | CC1CCN(c2nc3c(c(=O)[nH]c(=O)n3C)n2CCCSc2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C22H27N9O2S/c1-15-9-12-29(13-10-15)20-23-18-17(19(32)24-21(33)28(18)2)30(20)11-6-14-34-22-25-26-27-31(22)16-7-4-3-5-8-16/h3-5,7-8,15H,6,9-14H2,1-2H3,(H,24,32,33) |
| InChIKey | XXWGGEFOBPZFNH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|