C24H28N8O2S — CID 4283087
8-(4-benzylpiperazin-1-yl)-3-methyl-7-(3-pyrimidin-2-ylsulfanylpropyl)purine-2,6-dione (PubChem CID 4283087) has the molecular formula C24H28N8O2S and a molecular weight of 492.61 g/mol. Its IUPAC name is 8-(4-benzylpiperazin-1-yl)-3-methyl-7-(3-pyrimidin-2-ylsulfanylpropyl)purine-2,6-dione.
| Compound Name | 8-(4-benzylpiperazin-1-yl)-3-methyl-7-(3-pyrimidin-2-ylsulfanylpropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 4283087 |
| Molecular Formula | C24H28N8O2S |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 8-(4-benzylpiperazin-1-yl)-3-methyl-7-(3-pyrimidin-2-ylsulfanylpropyl)purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N1CCN(Cc3ccccc3)CC1)n2CCCSc1ncccn1 |
| InChI | InChI=1S/C24H28N8O2S/c1-29-20-19(21(33)28-24(29)34)32(11-6-16-35-22-25-9-5-10-26-22)23(27-20)31-14-12-30(13-15-31)17-18-7-3-2-4-8-18/h2-5,7-10H,6,11-17H2,1H3,(H,28,33,34) |
| InChIKey | CTTYLIXHSOOEJS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|