C18H25N8O2S+ — CID 7008372
3-methyl-8-(4-methylpiperazin-4-ium-1-yl)-7-(3-pyrimidin-2-ylsulfanylpropyl)purine-2,6-dione (PubChem CID 7008372) has the molecular formula C18H25N8O2S+ and a molecular weight of 417.52 g/mol. Its IUPAC name is 3-methyl-8-(4-methylpiperazin-4-ium-1-yl)-7-(3-pyrimidin-2-ylsulfanylpropyl)purine-2,6-dione.
| Compound Name | 3-methyl-8-(4-methylpiperazin-4-ium-1-yl)-7-(3-pyrimidin-2-ylsulfanylpropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 7008372 |
| Molecular Formula | C18H25N8O2S+ |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 3-methyl-8-(4-methylpiperazin-4-ium-1-yl)-7-(3-pyrimidin-2-ylsulfanylpropyl)purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N1CC[NH+](C)CC1)n2CCCSc1ncccn1 |
| InChI | InChI=1S/C18H24N8O2S/c1-23-8-10-25(11-9-23)17-21-14-13(15(27)22-18(28)24(14)2)26(17)7-4-12-29-16-19-5-3-6-20-16/h3,5-6H,4,7-12H2,1-2H3,(H,22,27,28)/p+1 |
| InChIKey | KMHLYRJSKVIOFC-UHFFFAOYSA-O |
| XLogP | -1.27 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|