C20H27N7O3S — CID 41106130
8-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-methyl-7-[3-(4-methylpyrimidin-2-yl)sulfanylpropyl]purine-2,6-dione (PubChem CID 41106130) has the molecular formula C20H27N7O3S and a molecular weight of 445.55 g/mol. Its IUPAC name is 8-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-methyl-7-[3-(4-methylpyrimidin-2-yl)sulfanylpropyl]purine-2,6-dione.
| Compound Name | 8-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-methyl-7-[3-(4-methylpyrimidin-2-yl)sulfanylpropyl]purine-2,6-dione |
|---|---|
| PubChem CID | 41106130 |
| Molecular Formula | C20H27N7O3S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 8-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-methyl-7-[3-(4-methylpyrimidin-2-yl)sulfanylpropyl]purine-2,6-dione |
| SMILES | Cc1ccnc(SCCCn2c(N3C[C@@H](C)O[C@H](C)C3)nc3c2c(=O)[nH]c(=O)n3C)n1 |
| InChI | InChI=1S/C20H27N7O3S/c1-12-6-7-21-18(22-12)31-9-5-8-27-15-16(25(4)20(29)24-17(15)28)23-19(27)26-10-13(2)30-14(3)11-26/h6-7,13-14H,5,8-11H2,1-4H3,(H,24,28,29)/t13-,14-/m1/s1 |
| InChIKey | ZBDIBSQCYNYKJY-ZIAGYGMSSA-N |
| XLogP | 1.32 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|