C15H17BrN6O2S — CID 4897575
8-bromo-7-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-3-methylpurine-2,6-dione (PubChem CID 4897575) has the molecular formula C15H17BrN6O2S and a molecular weight of 425.31 g/mol. Its IUPAC name is 8-bromo-7-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-bromo-7-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 4897575 |
| Molecular Formula | C15H17BrN6O2S |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | 8-bromo-7-[3-(4,6-dimethylpyrimidin-2-yl)sulfanylpropyl]-3-methylpurine-2,6-dione |
| SMILES | Cc1cc(C)nc(SCCCn2c(Br)nc3c2c(=O)[nH]c(=O)n3C)n1 |
| InChI | InChI=1S/C15H17BrN6O2S/c1-8-7-9(2)18-14(17-8)25-6-4-5-22-10-11(19-13(22)16)21(3)15(24)20-12(10)23/h7H,4-6H2,1-3H3,(H,20,23,24) |
| InChIKey | DXACGIXAFLHFBV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|