C16H15BrN6O2S — CID 3120030
7-[3-(1H-benzimidazol-2-ylsulfanyl)propyl]-8-bromo-3-methylpurine-2,6-dione (PubChem CID 3120030) has the molecular formula C16H15BrN6O2S and a molecular weight of 435.31 g/mol. Its IUPAC name is 7-[3-(1H-benzimidazol-2-ylsulfanyl)propyl]-8-bromo-3-methylpurine-2,6-dione.
| Compound Name | 7-[3-(1H-benzimidazol-2-ylsulfanyl)propyl]-8-bromo-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 3120030 |
| Molecular Formula | C16H15BrN6O2S |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 7-[3-(1H-benzimidazol-2-ylsulfanyl)propyl]-8-bromo-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(Br)n2CCCSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H15BrN6O2S/c1-22-12-11(13(24)21-16(22)25)23(14(17)20-12)7-4-8-26-15-18-9-5-2-3-6-10(9)19-15/h2-3,5-6H,4,7-8H2,1H3,(H,18,19)(H,21,24,25) |
| InChIKey | QYNQJCNSQMNTAR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|