C10H12Br2N4O2 — CID 16810382
8-bromo-7-(3-bromobutyl)-3-methylpurine-2,6-dione (PubChem CID 16810382) has the molecular formula C10H12Br2N4O2 and a molecular weight of 380.04 g/mol. Its IUPAC name is 8-bromo-7-(3-bromobutyl)-3-methylpurine-2,6-dione.
| Compound Name | 8-bromo-7-(3-bromobutyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 16810382 |
| Molecular Formula | C10H12Br2N4O2 |
| Molecular Weight | 380.04 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | 8-bromo-7-(3-bromobutyl)-3-methylpurine-2,6-dione |
| SMILES | CC(Br)CCn1c(Br)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C10H12Br2N4O2/c1-5(11)3-4-16-6-7(13-9(16)12)15(2)10(18)14-8(6)17/h5H,3-4H2,1-2H3,(H,14,17,18) |
| InChIKey | NZAGOZLDUKZZMA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.04 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|