C9H11BrN6O2S — CID 1396558
2-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)ethyl carbamimidothioate (PubChem CID 1396558) has the molecular formula C9H11BrN6O2S and a molecular weight of 347.20 g/mol. Its IUPAC name is 2-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)ethyl carbamimidothioate.
| Compound Name | 2-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)ethyl carbamimidothioate |
|---|---|
| PubChem CID | 1396558 |
| Molecular Formula | C9H11BrN6O2S |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | 2-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)ethyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCn1c(Br)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C9H11BrN6O2S/c1-15-5-4(6(17)14-9(15)18)16(7(10)13-5)2-3-19-8(11)12/h2-3H2,1H3,(H3,11,12)(H,14,17,18) |
| InChIKey | CCLLRGPVFJEBPC-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|