C22H26N4S2 — CID 13134043
2-[8-(1H-benzimidazol-2-ylsulfanyl)octylsulfanyl]-1H-benzimidazole (PubChem CID 13134043) has the molecular formula C22H26N4S2 and a molecular weight of 410.61 g/mol. Its IUPAC name is 2-[8-(1H-benzimidazol-2-ylsulfanyl)octylsulfanyl]-1H-benzimidazole.
| Compound Name | 2-[8-(1H-benzimidazol-2-ylsulfanyl)octylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 13134043 |
| Molecular Formula | C22H26N4S2 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-[8-(1H-benzimidazol-2-ylsulfanyl)octylsulfanyl]-1H-benzimidazole |
| SMILES | c1ccc2[nH]c(SCCCCCCCCSc3nc4ccccc4[nH]3)nc2c1 |
| InChI | InChI=1S/C22H26N4S2/c1(3-9-15-27-21-23-17-11-5-6-12-18(17)24-21)2-4-10-16-28-22-25-19-13-7-8-14-20(19)26-22/h5-8,11-14H,1-4,9-10,15-16H2,(H,23,24)(H,25,26) |
| InChIKey | TXKLMJKEHJQEQK-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|