C11H15N3S — CID 61386461
3-(1H-benzimidazol-2-ylsulfanyl)-N-methylpropan-1-amine (PubChem CID 61386461) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-ylsulfanyl)-N-methylpropan-1-amine.
| Compound Name | 3-(1H-benzimidazol-2-ylsulfanyl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 61386461 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 3-(1H-benzimidazol-2-ylsulfanyl)-N-methylpropan-1-amine |
| SMILES | CNCCCSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H15N3S/c1-12-7-4-8-15-11-13-9-5-2-3-6-10(9)14-11/h2-3,5-6,12H,4,7-8H2,1H3,(H,13,14) |
| InChIKey | FERMGHYIDGRIGS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|