C19H20N4S — CID 20685286
2-[5-(1H-benzimidazol-2-yl)pentylsulfanyl]-1H-benzimidazole (PubChem CID 20685286) has the molecular formula C19H20N4S and a molecular weight of 336.46 g/mol. Its IUPAC name is 2-[5-(1H-benzimidazol-2-yl)pentylsulfanyl]-1H-benzimidazole.
| Compound Name | 2-[5-(1H-benzimidazol-2-yl)pentylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 20685286 |
| Molecular Formula | C19H20N4S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2-[5-(1H-benzimidazol-2-yl)pentylsulfanyl]-1H-benzimidazole |
| SMILES | c1ccc2[nH]c(CCCCCSc3nc4ccccc4[nH]3)nc2c1 |
| InChI | InChI=1S/C19H20N4S/c1(2-12-18-20-14-8-3-4-9-15(14)21-18)7-13-24-19-22-16-10-5-6-11-17(16)23-19/h3-6,8-11H,1-2,7,12-13H2,(H,20,21)(H,22,23) |
| InChIKey | DERPKLQSKZWSGK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|