C20H22N4S2 — CID 14761294
2-[3-[3-(1H-benzimidazol-2-yl)propyldisulfanyl]propyl]-1H-benzimidazole (PubChem CID 14761294) has the molecular formula C20H22N4S2 and a molecular weight of 382.56 g/mol. Its IUPAC name is 2-[3-[3-(1H-benzimidazol-2-yl)propyldisulfanyl]propyl]-1H-benzimidazole.
| Compound Name | 2-[3-[3-(1H-benzimidazol-2-yl)propyldisulfanyl]propyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 14761294 |
| Molecular Formula | C20H22N4S2 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-[3-[3-(1H-benzimidazol-2-yl)propyldisulfanyl]propyl]-1H-benzimidazole |
| SMILES | c1ccc2[nH]c(CCCSSCCCc3nc4ccccc4[nH]3)nc2c1 |
| InChI | InChI=1S/C20H22N4S2/c1-2-8-16-15(7-1)21-19(22-16)11-5-13-25-26-14-6-12-20-23-17-9-3-4-10-18(17)24-20/h1-4,7-10H,5-6,11-14H2,(H,21,22)(H,23,24) |
| InChIKey | JWOOBCSOBNSNHY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|