C19H30N2S — CID 139610484
2-(2-decylsulfanylethyl)-1H-benzimidazole (PubChem CID 139610484) has the molecular formula C19H30N2S and a molecular weight of 318.53 g/mol. Its IUPAC name is 2-(2-decylsulfanylethyl)-1H-benzimidazole.
| Compound Name | 2-(2-decylsulfanylethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 139610484 |
| Molecular Formula | C19H30N2S |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 2-(2-decylsulfanylethyl)-1H-benzimidazole |
| SMILES | CCCCCCCCCCSCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H30N2S/c1-2-3-4-5-6-7-8-11-15-22-16-14-19-20-17-12-9-10-13-18(17)21-19/h9-10,12-13H,2-8,11,14-16H2,1H3,(H,20,21) |
| InChIKey | OOKOBNXZXUDGIN-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|