C12H17BrN2S — CID 171154912
2-pentylsulfanyl-1H-benzimidazole;hydrobromide (PubChem CID 171154912) has the molecular formula C12H17BrN2S and a molecular weight of 301.25 g/mol. Its IUPAC name is 2-pentylsulfanyl-1H-benzimidazole;hydrobromide.
| Compound Name | 2-pentylsulfanyl-1H-benzimidazole;hydrobromide |
|---|---|
| PubChem CID | 171154912 |
| Molecular Formula | C12H17BrN2S |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 2-pentylsulfanyl-1H-benzimidazole;hydrobromide |
| SMILES | Br.CCCCCSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C12H16N2S.BrH/c1-2-3-6-9-15-12-13-10-7-4-5-8-11(10)14-12;/h4-5,7-8H,2-3,6,9H2,1H3,(H,13,14);1H |
| InChIKey | YTHKZGXHUPEWHK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|