C12H17N3S — CID 64621123
5-(1H-benzimidazol-2-ylsulfanyl)pentan-2-amine (PubChem CID 64621123) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is 5-(1H-benzimidazol-2-ylsulfanyl)pentan-2-amine.
| Compound Name | 5-(1H-benzimidazol-2-ylsulfanyl)pentan-2-amine |
|---|---|
| PubChem CID | 64621123 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 5-(1H-benzimidazol-2-ylsulfanyl)pentan-2-amine |
| SMILES | CC(N)CCCSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C12H17N3S/c1-9(13)5-4-8-16-12-14-10-6-2-3-7-11(10)15-12/h2-3,6-7,9H,4-5,8,13H2,1H3,(H,14,15) |
| InChIKey | WCCQONOKRIIRQW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|