C15H23N3S — CID 106713292
6-(1H-benzimidazol-2-ylsulfanyl)-2,2-dimethylhexan-1-amine (PubChem CID 106713292) has the molecular formula C15H23N3S and a molecular weight of 277.44 g/mol. Its IUPAC name is 6-(1H-benzimidazol-2-ylsulfanyl)-2,2-dimethylhexan-1-amine.
| Compound Name | 6-(1H-benzimidazol-2-ylsulfanyl)-2,2-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 106713292 |
| Molecular Formula | C15H23N3S |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 6-(1H-benzimidazol-2-ylsulfanyl)-2,2-dimethylhexan-1-amine |
| SMILES | CC(C)(CN)CCCCSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H23N3S/c1-15(2,11-16)9-5-6-10-19-14-17-12-7-3-4-8-13(12)18-14/h3-4,7-8H,5-6,9-11,16H2,1-2H3,(H,17,18) |
| InChIKey | WYUHXZGZZBBMFD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|