C12H16N4S — CID 54965649
5-(1H-benzimidazol-2-ylsulfanyl)pentanimidamide (PubChem CID 54965649) has the molecular formula C12H16N4S and a molecular weight of 248.36 g/mol. Its IUPAC name is 5-(1H-benzimidazol-2-ylsulfanyl)pentanimidamide.
| Compound Name | 5-(1H-benzimidazol-2-ylsulfanyl)pentanimidamide |
|---|---|
| PubChem CID | 54965649 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 5-(1H-benzimidazol-2-ylsulfanyl)pentanimidamide |
| SMILES | [H]/N=C(\N)CCCCSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C12H16N4S/c13-11(14)7-3-4-8-17-12-15-9-5-1-2-6-10(9)16-12/h1-2,5-6H,3-4,7-8H2,(H3,13,14)(H,15,16) |
| InChIKey | GDWSGVUVAHSNGZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 78.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|