C13H21Br2N3S — CID 5351691
3-(1H-benzimidazol-2-ylsulfanyl)propyl-trimethylazanium;bromide;hydrobromide (PubChem CID 5351691) has the molecular formula C13H21Br2N3S and a molecular weight of 411.21 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-ylsulfanyl)propyl-trimethylazanium;bromide;hydrobromide.
| Compound Name | 3-(1H-benzimidazol-2-ylsulfanyl)propyl-trimethylazanium;bromide;hydrobromide |
|---|---|
| PubChem CID | 5351691 |
| Molecular Formula | C13H21Br2N3S |
| Molecular Weight | 411.21 g/mol |
| Exact Mass | 408.98 |
| IUPAC Name | 3-(1H-benzimidazol-2-ylsulfanyl)propyl-trimethylazanium;bromide;hydrobromide |
| SMILES | Br.C[N+](C)(C)CCCSc1nc2ccccc2[nH]1.[Br-] |
| InChI | InChI=1S/C13H20N3S.2BrH/c1-16(2,3)9-6-10-17-13-14-11-7-4-5-8-12(11)15-13;;/h4-5,7-8H,6,9-10H2,1-3H3,(H,14,15);2*1H/q+1;;/p-1 |
| InChIKey | HMKAYPYEPCCJTI-UHFFFAOYSA-M |
| XLogP | 0.33 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.21 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|