C12H16N2OS — CID 79175690
4-(1H-benzimidazol-2-ylsulfanyl)-2-methylbutan-2-ol (PubChem CID 79175690) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanyl)-2-methylbutan-2-ol.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanyl)-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 79175690 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanyl)-2-methylbutan-2-ol |
| SMILES | CC(C)(O)CCSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C12H16N2OS/c1-12(2,15)7-8-16-11-13-9-5-3-4-6-10(9)14-11/h3-6,15H,7-8H2,1-2H3,(H,13,14) |
| InChIKey | QXKPLIWCWBJGJP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |