C16H17N3S — CID 62585041
N-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-4-methylaniline (PubChem CID 62585041) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is N-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-4-methylaniline.
| Compound Name | N-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-4-methylaniline |
|---|---|
| PubChem CID | 62585041 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | N-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-4-methylaniline |
| SMILES | Cc1ccc(NCCSc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C16H17N3S/c1-12-6-8-13(9-7-12)17-10-11-20-16-18-14-4-2-3-5-15(14)19-16/h2-9,17H,10-11H2,1H3,(H,18,19) |
| InChIKey | HGLOOWDPHCEHDW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|