C14H14ClN5S — CID 110194434
2-N-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-6-chloropyridine-2,3-diamine (PubChem CID 110194434) has the molecular formula C14H14ClN5S and a molecular weight of 319.82 g/mol. Its IUPAC name is 2-N-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-6-chloropyridine-2,3-diamine.
| Compound Name | 2-N-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-6-chloropyridine-2,3-diamine |
|---|---|
| PubChem CID | 110194434 |
| Molecular Formula | C14H14ClN5S |
| Molecular Weight | 319.82 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-N-[2-(1H-benzimidazol-2-ylsulfanyl)ethyl]-6-chloropyridine-2,3-diamine |
| SMILES | Nc1ccc(Cl)nc1NCCSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H14ClN5S/c15-12-6-5-9(16)13(20-12)17-7-8-21-14-18-10-3-1-2-4-11(10)19-14/h1-6H,7-8,16H2,(H,17,20)(H,18,19) |
| InChIKey | GHTRMASVJYGUAI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.82 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|