C8H12ClN3S — CID 115474192
6-chloro-2-N-(2-methylsulfanylethyl)pyridine-2,3-diamine (PubChem CID 115474192) has the molecular formula C8H12ClN3S and a molecular weight of 217.73 g/mol. Its IUPAC name is 6-chloro-2-N-(2-methylsulfanylethyl)pyridine-2,3-diamine.
| Compound Name | 6-chloro-2-N-(2-methylsulfanylethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 115474192 |
| Molecular Formula | C8H12ClN3S |
| Molecular Weight | 217.73 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 6-chloro-2-N-(2-methylsulfanylethyl)pyridine-2,3-diamine |
| SMILES | CSCCNc1nc(Cl)ccc1N |
| InChI | InChI=1S/C8H12ClN3S/c1-13-5-4-11-8-6(10)2-3-7(9)12-8/h2-3H,4-5,10H2,1H3,(H,11,12) |
| InChIKey | WEQVNWGLXBGKLY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.73 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|