C9H15ClN4 — CID 24903980
6-chloro-2-N-[2-(dimethylamino)ethyl]pyridine-2,3-diamine (PubChem CID 24903980) has the molecular formula C9H15ClN4 and a molecular weight of 214.70 g/mol. Its IUPAC name is 6-chloro-2-N-[2-(dimethylamino)ethyl]pyridine-2,3-diamine.
| Compound Name | 6-chloro-2-N-[2-(dimethylamino)ethyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 24903980 |
| Molecular Formula | C9H15ClN4 |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 6-chloro-2-N-[2-(dimethylamino)ethyl]pyridine-2,3-diamine |
| SMILES | CN(C)CCNc1nc(Cl)ccc1N |
| InChI | InChI=1S/C9H15ClN4/c1-14(2)6-5-12-9-7(11)3-4-8(10)13-9/h3-4H,5-6,11H2,1-2H3,(H,12,13) |
| InChIKey | ROZJYLMHMRFBPW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|