C11H14ClN5 — CID 114143853
6-chloro-2-N-[2-(1-methylpyrazol-3-yl)ethyl]pyridine-2,3-diamine (PubChem CID 114143853) has the molecular formula C11H14ClN5 and a molecular weight of 251.72 g/mol. Its IUPAC name is 6-chloro-2-N-[2-(1-methylpyrazol-3-yl)ethyl]pyridine-2,3-diamine.
| Compound Name | 6-chloro-2-N-[2-(1-methylpyrazol-3-yl)ethyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 114143853 |
| Molecular Formula | C11H14ClN5 |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 6-chloro-2-N-[2-(1-methylpyrazol-3-yl)ethyl]pyridine-2,3-diamine |
| SMILES | Cn1ccc(CCNc2nc(Cl)ccc2N)n1 |
| InChI | InChI=1S/C11H14ClN5/c1-17-7-5-8(16-17)4-6-14-11-9(13)2-3-10(12)15-11/h2-3,5,7H,4,6,13H2,1H3,(H,14,15) |
| InChIKey | RIMLRCGJZCNNMT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|