C11H12Cl2N4 — CID 114144034
3,5-dichloro-N-[2-(1-methylpyrazol-3-yl)ethyl]pyridin-2-amine (PubChem CID 114144034) has the molecular formula C11H12Cl2N4 and a molecular weight of 271.15 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(1-methylpyrazol-3-yl)ethyl]pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-[2-(1-methylpyrazol-3-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 114144034 |
| Molecular Formula | C11H12Cl2N4 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 3,5-dichloro-N-[2-(1-methylpyrazol-3-yl)ethyl]pyridin-2-amine |
| SMILES | Cn1ccc(CCNc2ncc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C11H12Cl2N4/c1-17-5-3-9(16-17)2-4-14-11-10(13)6-8(12)7-15-11/h3,5-7H,2,4H2,1H3,(H,14,15) |
| InChIKey | DLVIABVTOZMYJS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |