C11H10ClF3N4 — CID 82872733
3-chloro-N-[(1-methylpyrazol-3-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 82872733) has the molecular formula C11H10ClF3N4 and a molecular weight of 290.68 g/mol. Its IUPAC name is 3-chloro-N-[(1-methylpyrazol-3-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-[(1-methylpyrazol-3-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 82872733 |
| Molecular Formula | C11H10ClF3N4 |
| Molecular Weight | 290.68 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 3-chloro-N-[(1-methylpyrazol-3-yl)methyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cn1ccc(CNc2ncc(C(F)(F)F)cc2Cl)n1 |
| InChI | InChI=1S/C11H10ClF3N4/c1-19-3-2-8(18-19)6-17-10-9(12)4-7(5-16-10)11(13,14)15/h2-5H,6H2,1H3,(H,16,17) |
| InChIKey | JWMVUNNFWMXAOV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.68 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |