C10H9ClF3N5 — CID 114562824
2-chloro-N-[(1-methylpyrazol-3-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 114562824) has the molecular formula C10H9ClF3N5 and a molecular weight of 291.66 g/mol. Its IUPAC name is 2-chloro-N-[(1-methylpyrazol-3-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-[(1-methylpyrazol-3-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114562824 |
| Molecular Formula | C10H9ClF3N5 |
| Molecular Weight | 291.66 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 2-chloro-N-[(1-methylpyrazol-3-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Cn1ccc(CNc2cc(C(F)(F)F)nc(Cl)n2)n1 |
| InChI | InChI=1S/C10H9ClF3N5/c1-19-3-2-6(18-19)5-15-8-4-7(10(12,13)14)16-9(11)17-8/h2-4H,5H2,1H3,(H,15,16,17) |
| InChIKey | IGUCYDLBQNTLBD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.66 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |