C12H13ClF3N5 — CID 114562843
2-chloro-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 114562843) has the molecular formula C12H13ClF3N5 and a molecular weight of 319.72 g/mol. Its IUPAC name is 2-chloro-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114562843 |
| Molecular Formula | C12H13ClF3N5 |
| Molecular Weight | 319.72 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 2-chloro-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CCc1nn(C)cc1CNc1cc(C(F)(F)F)nc(Cl)n1 |
| InChI | InChI=1S/C12H13ClF3N5/c1-3-8-7(6-21(2)20-8)5-17-10-4-9(12(14,15)16)18-11(13)19-10/h4,6H,3,5H2,1-2H3,(H,17,18,19) |
| InChIKey | NZXHVPVHHACYIB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.72 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |