C13H15ClFN3 — CID 112668861
4-chloro-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-2-fluoroaniline (PubChem CID 112668861) has the molecular formula C13H15ClFN3 and a molecular weight of 267.74 g/mol. Its IUPAC name is 4-chloro-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-2-fluoroaniline.
| Compound Name | 4-chloro-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-2-fluoroaniline |
|---|---|
| PubChem CID | 112668861 |
| Molecular Formula | C13H15ClFN3 |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 4-chloro-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-2-fluoroaniline |
| SMILES | CCc1nn(C)cc1CNc1ccc(Cl)cc1F |
| InChI | InChI=1S/C13H15ClFN3/c1-3-12-9(8-18(2)17-12)7-16-13-5-4-10(14)6-11(13)15/h4-6,8,16H,3,7H2,1-2H3 |
| InChIKey | OPDRRKAPAWGCND-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |