C14H17BrFN3 — CID 103271245
5-bromo-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-fluoro-2-methylaniline (PubChem CID 103271245) has the molecular formula C14H17BrFN3 and a molecular weight of 326.21 g/mol. Its IUPAC name is 5-bromo-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-fluoro-2-methylaniline.
| Compound Name | 5-bromo-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-fluoro-2-methylaniline |
|---|---|
| PubChem CID | 103271245 |
| Molecular Formula | C14H17BrFN3 |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 5-bromo-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-fluoro-2-methylaniline |
| SMILES | CCc1nn(C)cc1CNc1cc(Br)c(F)cc1C |
| InChI | InChI=1S/C14H17BrFN3/c1-4-13-10(8-19(3)18-13)7-17-14-6-11(15)12(16)5-9(14)2/h5-6,8,17H,4,7H2,1-3H3 |
| InChIKey | UGZOGFNWIQGXDO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |