C13H14Br3N3 — CID 112668796
2,4,6-tribromo-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]aniline (PubChem CID 112668796) has the molecular formula C13H14Br3N3 and a molecular weight of 451.99 g/mol. Its IUPAC name is 2,4,6-tribromo-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]aniline.
| Compound Name | 2,4,6-tribromo-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 112668796 |
| Molecular Formula | C13H14Br3N3 |
| Molecular Weight | 451.99 g/mol |
| Exact Mass | 448.87 |
| IUPAC Name | 2,4,6-tribromo-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]aniline |
| SMILES | CCc1nn(C)cc1CNc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C13H14Br3N3/c1-3-12-8(7-19(2)18-12)6-17-13-10(15)4-9(14)5-11(13)16/h4-5,7,17H,3,6H2,1-2H3 |
| InChIKey | XRPINHCRJZSBNK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.99 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |