C16H17BrN4 — CID 116783312
3-bromo-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]quinolin-8-amine (PubChem CID 116783312) has the molecular formula C16H17BrN4 and a molecular weight of 345.24 g/mol. Its IUPAC name is 3-bromo-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]quinolin-8-amine.
| Compound Name | 3-bromo-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]quinolin-8-amine |
|---|---|
| PubChem CID | 116783312 |
| Molecular Formula | C16H17BrN4 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 3-bromo-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]quinolin-8-amine |
| SMILES | CCc1nn(C)cc1CNc1cccc2cc(Br)cnc12 |
| InChI | InChI=1S/C16H17BrN4/c1-3-14-12(10-21(2)20-14)8-18-15-6-4-5-11-7-13(17)9-19-16(11)15/h4-7,9-10,18H,3,8H2,1-2H3 |
| InChIKey | ILXZPWYIGSJQJL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |