C16H11BrF2N2 — CID 116783545
3-bromo-N-[(2,3-difluorophenyl)methyl]quinolin-8-amine (PubChem CID 116783545) has the molecular formula C16H11BrF2N2 and a molecular weight of 349.18 g/mol. Its IUPAC name is 3-bromo-N-[(2,3-difluorophenyl)methyl]quinolin-8-amine.
| Compound Name | 3-bromo-N-[(2,3-difluorophenyl)methyl]quinolin-8-amine |
|---|---|
| PubChem CID | 116783545 |
| Molecular Formula | C16H11BrF2N2 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 3-bromo-N-[(2,3-difluorophenyl)methyl]quinolin-8-amine |
| SMILES | Fc1cccc(CNc2cccc3cc(Br)cnc23)c1F |
| InChI | InChI=1S/C16H11BrF2N2/c17-12-7-10-3-2-6-14(16(10)21-9-12)20-8-11-4-1-5-13(18)15(11)19/h1-7,9,20H,8H2 |
| InChIKey | BNFSYHVKRFQFEF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |