C12H7Cl2F4N3 — CID 114562561
2-chloro-N-[(3-chloro-4-fluorophenyl)methyl]-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 114562561) has the molecular formula C12H7Cl2F4N3 and a molecular weight of 340.11 g/mol. Its IUPAC name is 2-chloro-N-[(3-chloro-4-fluorophenyl)methyl]-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-[(3-chloro-4-fluorophenyl)methyl]-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114562561 |
| Molecular Formula | C12H7Cl2F4N3 |
| Molecular Weight | 340.11 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 2-chloro-N-[(3-chloro-4-fluorophenyl)methyl]-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Fc1ccc(CNc2cc(C(F)(F)F)nc(Cl)n2)cc1Cl |
| InChI | InChI=1S/C12H7Cl2F4N3/c13-7-3-6(1-2-8(7)15)5-19-10-4-9(12(16,17)18)20-11(14)21-10/h1-4H,5H2,(H,19,20,21) |
| InChIKey | LEDCXZFAKGKRGJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.11 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |