C14H14Cl2FN3 — CID 80939443
6-chloro-N-[(3-chloro-4-fluorophenyl)methyl]-2-propylpyrimidin-4-amine (PubChem CID 80939443) has the molecular formula C14H14Cl2FN3 and a molecular weight of 314.19 g/mol. Its IUPAC name is 6-chloro-N-[(3-chloro-4-fluorophenyl)methyl]-2-propylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-[(3-chloro-4-fluorophenyl)methyl]-2-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80939443 |
| Molecular Formula | C14H14Cl2FN3 |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 6-chloro-N-[(3-chloro-4-fluorophenyl)methyl]-2-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(Cl)cc(NCc2ccc(F)c(Cl)c2)n1 |
| InChI | InChI=1S/C14H14Cl2FN3/c1-2-3-13-19-12(16)7-14(20-13)18-8-9-4-5-11(17)10(15)6-9/h4-7H,2-3,8H2,1H3,(H,18,19,20) |
| InChIKey | PDNIUHVKFWDBOO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |