C14H16F2N4 — CID 80954744
4-N-[(3,4-difluorophenyl)methyl]-2-propylpyrimidine-4,6-diamine (PubChem CID 80954744) has the molecular formula C14H16F2N4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-N-[(3,4-difluorophenyl)methyl]-2-propylpyrimidine-4,6-diamine.
| Compound Name | 4-N-[(3,4-difluorophenyl)methyl]-2-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80954744 |
| Molecular Formula | C14H16F2N4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-N-[(3,4-difluorophenyl)methyl]-2-propylpyrimidine-4,6-diamine |
| SMILES | CCCc1nc(N)cc(NCc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C14H16F2N4/c1-2-3-13-19-12(17)7-14(20-13)18-8-9-4-5-10(15)11(16)6-9/h4-7H,2-3,8H2,1H3,(H3,17,18,19,20) |
| InChIKey | SCMWGYUFHBMBHX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |