C9H11ClFN — CID 62538918
N-[(3-chloro-4-fluorophenyl)methyl]ethanamine (PubChem CID 62538918) has the molecular formula C9H11ClFN and a molecular weight of 187.65 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]ethanamine.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 62538918 |
| Molecular Formula | C9H11ClFN |
| Molecular Weight | 187.65 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]ethanamine |
| SMILES | CCNCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C9H11ClFN/c1-2-12-6-7-3-4-9(11)8(10)5-7/h3-5,12H,2,6H2,1H3 |
| InChIKey | NZESHMHIHLMUFX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.65 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |