C14H26ClFN2 — CID 144872416
N'-[(3-chloro-4-fluorophenyl)methyl]-N-methylethane-1,2-diamine;ethane (PubChem CID 144872416) has the molecular formula C14H26ClFN2 and a molecular weight of 276.83 g/mol. Its IUPAC name is N'-[(3-chloro-4-fluorophenyl)methyl]-N-methylethane-1,2-diamine;ethane.
| Compound Name | N'-[(3-chloro-4-fluorophenyl)methyl]-N-methylethane-1,2-diamine;ethane |
|---|---|
| PubChem CID | 144872416 |
| Molecular Formula | C14H26ClFN2 |
| Molecular Weight | 276.83 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N'-[(3-chloro-4-fluorophenyl)methyl]-N-methylethane-1,2-diamine;ethane |
| SMILES | CC.CC.CNCCNCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C10H14ClFN2.2C2H6/c1-13-4-5-14-7-8-2-3-10(12)9(11)6-8;2*1-2/h2-3,6,13-14H,4-5,7H2,1H3;2*1-2H3 |
| InChIKey | UYIOCCBYBWSANJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.83 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|