C10H14Cl2N2 — CID 91353491
N'-[(3,5-dichlorophenyl)methyl]-N-methylethane-1,2-diamine (PubChem CID 91353491) has the molecular formula C10H14Cl2N2 and a molecular weight of 233.14 g/mol. Its IUPAC name is N'-[(3,5-dichlorophenyl)methyl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[(3,5-dichlorophenyl)methyl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 91353491 |
| Molecular Formula | C10H14Cl2N2 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | N'-[(3,5-dichlorophenyl)methyl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H14Cl2N2/c1-13-2-3-14-7-8-4-9(11)6-10(12)5-8/h4-6,13-14H,2-3,7H2,1H3 |
| InChIKey | ILMKNFUCOROTFM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|