C12H14Cl2F3N — CID 115491413
N-[(3,5-dichlorophenyl)methyl]-5,5,5-trifluoropentan-1-amine (PubChem CID 115491413) has the molecular formula C12H14Cl2F3N and a molecular weight of 300.15 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)methyl]-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-[(3,5-dichlorophenyl)methyl]-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 115491413 |
| Molecular Formula | C12H14Cl2F3N |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N-[(3,5-dichlorophenyl)methyl]-5,5,5-trifluoropentan-1-amine |
| SMILES | FC(F)(F)CCCCNCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2F3N/c13-10-5-9(6-11(14)7-10)8-18-4-2-1-3-12(15,16)17/h5-7,18H,1-4,8H2 |
| InChIKey | DMWTZUBLMQVENE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|