C12H16ClF3N2 — CID 113327738
3-chloro-5-[(5,5,5-trifluoropentylamino)methyl]aniline (PubChem CID 113327738) has the molecular formula C12H16ClF3N2 and a molecular weight of 280.72 g/mol. Its IUPAC name is 3-chloro-5-[(5,5,5-trifluoropentylamino)methyl]aniline.
| Compound Name | 3-chloro-5-[(5,5,5-trifluoropentylamino)methyl]aniline |
|---|---|
| PubChem CID | 113327738 |
| Molecular Formula | C12H16ClF3N2 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 3-chloro-5-[(5,5,5-trifluoropentylamino)methyl]aniline |
| SMILES | Nc1cc(Cl)cc(CNCCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H16ClF3N2/c13-10-5-9(6-11(17)7-10)8-18-4-2-1-3-12(14,15)16/h5-7,18H,1-4,8,17H2 |
| InChIKey | WLTABTFAWZGZMZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|