C11H13Cl2F3N2O2S — CID 115515168
4-amino-2,6-dichloro-N-(5,5,5-trifluoropentyl)benzenesulfonamide (PubChem CID 115515168) has the molecular formula C11H13Cl2F3N2O2S and a molecular weight of 365.20 g/mol. Its IUPAC name is 4-amino-2,6-dichloro-N-(5,5,5-trifluoropentyl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dichloro-N-(5,5,5-trifluoropentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115515168 |
| Molecular Formula | C11H13Cl2F3N2O2S |
| Molecular Weight | 365.20 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 4-amino-2,6-dichloro-N-(5,5,5-trifluoropentyl)benzenesulfonamide |
| SMILES | Nc1cc(Cl)c(S(=O)(=O)NCCCCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2F3N2O2S/c12-8-5-7(17)6-9(13)10(8)21(19,20)18-4-2-1-3-11(14,15)16/h5-6,18H,1-4,17H2 |
| InChIKey | BOVCZMWFTXVXJC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.20 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|