C9H12Cl2N2O2S2 — CID 63981794
4-amino-2,6-dichloro-N-(2-methylsulfanylethyl)benzenesulfonamide (PubChem CID 63981794) has the molecular formula C9H12Cl2N2O2S2 and a molecular weight of 315.25 g/mol. Its IUPAC name is 4-amino-2,6-dichloro-N-(2-methylsulfanylethyl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dichloro-N-(2-methylsulfanylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63981794 |
| Molecular Formula | C9H12Cl2N2O2S2 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | 4-amino-2,6-dichloro-N-(2-methylsulfanylethyl)benzenesulfonamide |
| SMILES | CSCCNS(=O)(=O)c1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C9H12Cl2N2O2S2/c1-16-3-2-13-17(14,15)9-7(10)4-6(12)5-8(9)11/h4-5,13H,2-3,12H2,1H3 |
| InChIKey | OVUMKOKGIVWRRC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|