C10H15Cl2N3O2S — CID 43257027
4-amino-2,6-dichloro-N-[2-(dimethylamino)ethyl]benzenesulfonamide (PubChem CID 43257027) has the molecular formula C10H15Cl2N3O2S and a molecular weight of 312.22 g/mol. Its IUPAC name is 4-amino-2,6-dichloro-N-[2-(dimethylamino)ethyl]benzenesulfonamide.
| Compound Name | 4-amino-2,6-dichloro-N-[2-(dimethylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43257027 |
| Molecular Formula | C10H15Cl2N3O2S |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 4-amino-2,6-dichloro-N-[2-(dimethylamino)ethyl]benzenesulfonamide |
| SMILES | CN(C)CCNS(=O)(=O)c1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C10H15Cl2N3O2S/c1-15(2)4-3-14-18(16,17)10-8(11)5-7(13)6-9(10)12/h5-6,14H,3-4,13H2,1-2H3 |
| InChIKey | YYAUHRQXOVLJSL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|